C23H25F2NO2 — CID 23052009
2,3-difluoro-4-[[4-(4-propoxycyclohexyl)phenyl]methoxy]benzonitrile (PubChem CID 23052009) has the molecular formula C23H25F2NO2 and a molecular weight of 385.45 g/mol. Its IUPAC name is 2,3-difluoro-4-[[4-(4-propoxycyclohexyl)phenyl]methoxy]benzonitrile.
| Compound Name | 2,3-difluoro-4-[[4-(4-propoxycyclohexyl)phenyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 23052009 |
| Molecular Formula | C23H25F2NO2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2,3-difluoro-4-[[4-(4-propoxycyclohexyl)phenyl]methoxy]benzonitrile |
| SMILES | CCCOC1CCC(c2ccc(COc3ccc(C#N)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H25F2NO2/c1-2-13-27-20-10-7-18(8-11-20)17-5-3-16(4-6-17)15-28-21-12-9-19(14-26)22(24)23(21)25/h3-6,9,12,18,20H,2,7-8,10-11,13,15H2,1H3 |
| InChIKey | NJVMJVIRJJCBKS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |