C19H19F2NO — CID 23051969
2,3-difluoro-4-[(4-pentylphenyl)methoxy]benzonitrile (PubChem CID 23051969) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is 2,3-difluoro-4-[(4-pentylphenyl)methoxy]benzonitrile.
| Compound Name | 2,3-difluoro-4-[(4-pentylphenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 23051969 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2,3-difluoro-4-[(4-pentylphenyl)methoxy]benzonitrile |
| SMILES | CCCCCc1ccc(COc2ccc(C#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H19F2NO/c1-2-3-4-5-14-6-8-15(9-7-14)13-23-17-11-10-16(12-22)18(20)19(17)21/h6-11H,2-5,13H2,1H3 |
| InChIKey | XBZHMNXIGVGEDA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|