C22H23F2NO2 — CID 23051958
4-[[4-(4-ethoxycyclohexyl)phenyl]methoxy]-2,3-difluorobenzonitrile (PubChem CID 23051958) has the molecular formula C22H23F2NO2 and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-[[4-(4-ethoxycyclohexyl)phenyl]methoxy]-2,3-difluorobenzonitrile.
| Compound Name | 4-[[4-(4-ethoxycyclohexyl)phenyl]methoxy]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 23051958 |
| Molecular Formula | C22H23F2NO2 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-[[4-(4-ethoxycyclohexyl)phenyl]methoxy]-2,3-difluorobenzonitrile |
| SMILES | CCOC1CCC(c2ccc(COc3ccc(C#N)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C22H23F2NO2/c1-2-26-19-10-7-17(8-11-19)16-5-3-15(4-6-16)14-27-20-12-9-18(13-25)21(23)22(20)24/h3-6,9,12,17,19H,2,7-8,10-11,14H2,1H3 |
| InChIKey | BNOQOSIKHQTRGC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |