C23H28F4O3S — CID 139850018
[1-fluoro-6-(4-hexylcyclohexyl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 139850018) has the molecular formula C23H28F4O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is [1-fluoro-6-(4-hexylcyclohexyl)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-fluoro-6-(4-hexylcyclohexyl)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139850018 |
| Molecular Formula | C23H28F4O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [1-fluoro-6-(4-hexylcyclohexyl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCCCC1CCC(c2ccc3c(F)c(OS(=O)(=O)C(F)(F)F)ccc3c2)CC1 |
| InChI | InChI=1S/C23H28F4O3S/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-20-19(15-18)12-14-21(22(20)24)30-31(28,29)23(25,26)27/h11-17H,2-10H2,1H3 |
| InChIKey | WKXWGXBZXDLUMZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|