C25H27F2NO5 — CID 54553363
(4-cyano-2,3-difluorophenyl) 4-(5-heptoxy-1,4-dioxan-2-yl)benzoate (PubChem CID 54553363) has the molecular formula C25H27F2NO5 and a molecular weight of 459.49 g/mol. Its IUPAC name is (4-cyano-2,3-difluorophenyl) 4-(5-heptoxy-1,4-dioxan-2-yl)benzoate.
| Compound Name | (4-cyano-2,3-difluorophenyl) 4-(5-heptoxy-1,4-dioxan-2-yl)benzoate |
|---|---|
| PubChem CID | 54553363 |
| Molecular Formula | C25H27F2NO5 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (4-cyano-2,3-difluorophenyl) 4-(5-heptoxy-1,4-dioxan-2-yl)benzoate |
| SMILES | CCCCCCCOC1COC(c2ccc(C(=O)Oc3ccc(C#N)c(F)c3F)cc2)CO1 |
| InChI | InChI=1S/C25H27F2NO5/c1-2-3-4-5-6-13-30-22-16-31-21(15-32-22)17-7-9-18(10-8-17)25(29)33-20-12-11-19(14-28)23(26)24(20)27/h7-12,21-22H,2-6,13,15-16H2,1H3 |
| InChIKey | ZLLFGNTXZDIQPO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|