C25H33F3O — CID 118316610
1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 118316610) has the molecular formula C25H33F3O and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 118316610 |
| Molecular Formula | C25H33F3O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | CCOc1ccc(C2=CCC(C3CCC(/C=C/CCCF)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C25H33F3O/c1-2-29-23-16-15-22(24(27)25(23)28)21-13-11-20(12-14-21)19-9-7-18(8-10-19)6-4-3-5-17-26/h4,6,13,15-16,18-20H,2-3,5,7-12,14,17H2,1H3/b6-4+ |
| InChIKey | VTHGYSPPZLDQDW-GQCTYLIASA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|