C15H26 — CID 148827626
1-ethyl-4-(4-methylcyclohexyl)cyclohexene (PubChem CID 148827626) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1-ethyl-4-(4-methylcyclohexyl)cyclohexene.
| Compound Name | 1-ethyl-4-(4-methylcyclohexyl)cyclohexene |
|---|---|
| PubChem CID | 148827626 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1-ethyl-4-(4-methylcyclohexyl)cyclohexene |
| SMILES | CCC1=CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C15H26/c1-3-13-6-10-15(11-7-13)14-8-4-12(2)5-9-14/h6,12,14-15H,3-5,7-11H2,1-2H3 |
| InChIKey | OTAUGGMEABLGBG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|