C21H38F2O — CID 142421435
3,4-difluoro-5-[4-(4-methylcyclohexyl)cyclohexen-1-yl]hexan-2-ol;ethane (PubChem CID 142421435) has the molecular formula C21H38F2O and a molecular weight of 344.53 g/mol. Its IUPAC name is 3,4-difluoro-5-[4-(4-methylcyclohexyl)cyclohexen-1-yl]hexan-2-ol;ethane.
| Compound Name | 3,4-difluoro-5-[4-(4-methylcyclohexyl)cyclohexen-1-yl]hexan-2-ol;ethane |
|---|---|
| PubChem CID | 142421435 |
| Molecular Formula | C21H38F2O |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 3,4-difluoro-5-[4-(4-methylcyclohexyl)cyclohexen-1-yl]hexan-2-ol;ethane |
| SMILES | CC.CC1CCC(C2CC=C(C(C)C(F)C(F)C(C)O)CC2)CC1 |
| InChI | InChI=1S/C19H32F2O.C2H6/c1-12-4-6-16(7-5-12)17-10-8-15(9-11-17)13(2)18(20)19(21)14(3)22;1-2/h8,12-14,16-19,22H,4-7,9-11H2,1-3H3;1-2H3 |
| InChIKey | RLLRAFHZWRFCDQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|