C13H23BO2 — CID 145005860
[4-(4-methylcyclohexyl)cyclohexen-1-yl]boronic acid (PubChem CID 145005860) has the molecular formula C13H23BO2 and a molecular weight of 222.14 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)cyclohexen-1-yl]boronic acid.
| Compound Name | [4-(4-methylcyclohexyl)cyclohexen-1-yl]boronic acid |
|---|---|
| PubChem CID | 145005860 |
| Molecular Formula | C13H23BO2 |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [4-(4-methylcyclohexyl)cyclohexen-1-yl]boronic acid |
| SMILES | CC1CCC(C2CC=C(B(O)O)CC2)CC1 |
| InChI | InChI=1S/C13H23BO2/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16/h8,10-12,15-16H,2-7,9H2,1H3 |
| InChIKey | RXDFDULLUIRSCA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|