C26H38O7 — CID 70372070
3-hydroxy-2,2-dimethyl-4-[4-(4-pentylcyclohexyl)benzoyl]oxyhexanedioic acid (PubChem CID 70372070) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-4-[4-(4-pentylcyclohexyl)benzoyl]oxyhexanedioic acid.
| Compound Name | 3-hydroxy-2,2-dimethyl-4-[4-(4-pentylcyclohexyl)benzoyl]oxyhexanedioic acid |
|---|---|
| PubChem CID | 70372070 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-4-[4-(4-pentylcyclohexyl)benzoyl]oxyhexanedioic acid |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)OC(CC(=O)O)C(O)C(C)(C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C26H38O7/c1-4-5-6-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)24(30)33-21(16-22(27)28)23(29)26(2,3)25(31)32/h12-15,17-18,21,23,29H,4-11,16H2,1-3H3,(H,27,28)(H,31,32) |
| InChIKey | SXBGFQCBBVUBDE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|