C8H15N3O — CID 155700970
N-methyl-1H-pyrazole-4-carboxamide;propane (PubChem CID 155700970) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is N-methyl-1H-pyrazole-4-carboxamide;propane.
| Compound Name | N-methyl-1H-pyrazole-4-carboxamide;propane |
|---|---|
| PubChem CID | 155700970 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-methyl-1H-pyrazole-4-carboxamide;propane |
| SMILES | CCC.CNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C5H7N3O.C3H8/c1-6-5(9)4-2-7-8-3-4;1-3-2/h2-3H,1H3,(H,6,9)(H,7,8);3H2,1-2H3 |
| InChIKey | GJOODEKVOQBJJN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |