C9H15N3OS — CID 115662264
N-(1-ethylsulfanylpropan-2-yl)-1H-pyrazole-4-carboxamide (PubChem CID 115662264) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-(1-ethylsulfanylpropan-2-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1-ethylsulfanylpropan-2-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115662264 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(1-ethylsulfanylpropan-2-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CCSCC(C)NC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-14-6-7(2)12-9(13)8-4-10-11-5-8/h4-5,7H,3,6H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | IZABCZQTCLEOAG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |