C9H15N3O2 — CID 115649315
N-(2-ethoxypropyl)-1H-pyrazole-4-carboxamide (PubChem CID 115649315) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(2-ethoxypropyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-ethoxypropyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115649315 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-ethoxypropyl)-1H-pyrazole-4-carboxamide |
| SMILES | CCOC(C)CNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-14-7(2)4-10-9(13)8-5-11-12-6-8/h5-7H,3-4H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | ZTSKLMCQGLTZQP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |