C12H15F3N2O3S — CID 63862461
3,4,5-trifluoro-N-[2-(methanesulfonamido)-2-methylpropyl]benzamide (PubChem CID 63862461) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[2-(methanesulfonamido)-2-methylpropyl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[2-(methanesulfonamido)-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 63862461 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3,4,5-trifluoro-N-[2-(methanesulfonamido)-2-methylpropyl]benzamide |
| SMILES | CC(C)(CNC(=O)c1cc(F)c(F)c(F)c1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H15F3N2O3S/c1-12(2,17-21(3,19)20)6-16-11(18)7-4-8(13)10(15)9(14)5-7/h4-5,17H,6H2,1-3H3,(H,16,18) |
| InChIKey | MZPVUVZMRAUMAM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|