C12H19FN4O3S — CID 105386402
3-fluoro-N-[2-(methanesulfonamido)-2-methylpropyl]-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105386402) has the molecular formula C12H19FN4O3S and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-fluoro-N-[2-(methanesulfonamido)-2-methylpropyl]-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[2-(methanesulfonamido)-2-methylpropyl]-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386402 |
| Molecular Formula | C12H19FN4O3S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-fluoro-N-[2-(methanesulfonamido)-2-methylpropyl]-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCC(C)(C)NS(C)(=O)=O)c1F |
| InChI | InChI=1S/C12H19FN4O3S/c1-12(2,17-21(4,19)20)7-16-11(18)8-5-6-15-10(14-3)9(8)13/h5-6,17H,7H2,1-4H3,(H,14,15)(H,16,18) |
| InChIKey | CDXJOOALDNNTQV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |