C11H16FN3O3S — CID 105386606
3-fluoro-2-(methylamino)-N-(1-methylsulfonylpropan-2-yl)pyridine-4-carboxamide (PubChem CID 105386606) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-(1-methylsulfonylpropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-(1-methylsulfonylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386606 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-(1-methylsulfonylpropan-2-yl)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NC(C)CS(C)(=O)=O)c1F |
| InChI | InChI=1S/C11H16FN3O3S/c1-7(6-19(3,17)18)15-11(16)8-4-5-14-10(13-2)9(8)12/h4-5,7H,6H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | BGMPRCKHIWFVHT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |