C13H22N4O3S — CID 105070214
3-(ethylamino)-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-4-carboxamide (PubChem CID 105070214) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-(ethylamino)-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-4-carboxamide.
| Compound Name | 3-(ethylamino)-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105070214 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-(ethylamino)-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C13H22N4O3S/c1-5-15-11-8-14-7-6-10(11)12(18)16-9-13(2,3)17-21(4,19)20/h6-8,15,17H,5,9H2,1-4H3,(H,16,18) |
| InChIKey | NIWDORHLUWAXGP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |