C10H10F5N3O — CID 106295596
3-fluoro-2-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 106295596) has the molecular formula C10H10F5N3O and a molecular weight of 283.20 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106295596 |
| Molecular Formula | C10H10F5N3O |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCC(F)(F)C(F)F)c1F |
| InChI | InChI=1S/C10H10F5N3O/c1-16-7-6(11)5(2-3-17-7)8(19)18-4-10(14,15)9(12)13/h2-3,9H,4H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | LEECKDFFLJBZLV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|