C11H18ClN5O3S — CID 63861191
5-chloro-6-hydrazinyl-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-carboxamide (PubChem CID 63861191) has the molecular formula C11H18ClN5O3S and a molecular weight of 335.82 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63861191 |
| Molecular Formula | C11H18ClN5O3S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-[2-(methanesulfonamido)-2-methylpropyl]pyridine-3-carboxamide |
| SMILES | CC(C)(CNC(=O)c1cnc(NN)c(Cl)c1)NS(C)(=O)=O |
| InChI | InChI=1S/C11H18ClN5O3S/c1-11(2,17-21(3,19)20)6-15-10(18)7-4-8(12)9(16-13)14-5-7/h4-5,17H,6,13H2,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | CMNZTMWDMWQXLI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|