C10H16ClN5O3S — CID 106340809
5-chloro-6-hydrazinyl-N-[3-(methanesulfonamido)propyl]pyridine-3-carboxamide (PubChem CID 106340809) has the molecular formula C10H16ClN5O3S and a molecular weight of 321.79 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-[3-(methanesulfonamido)propyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-[3-(methanesulfonamido)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106340809 |
| Molecular Formula | C10H16ClN5O3S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-[3-(methanesulfonamido)propyl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C10H16ClN5O3S/c1-20(18,19)15-4-2-3-13-10(17)7-5-8(11)9(16-12)14-6-7/h5-6,15H,2-4,12H2,1H3,(H,13,17)(H,14,16) |
| InChIKey | UGULISBTUJHVHS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|