C12H19N3O2 — CID 106140156
N-(4-amino-2,2-dimethylbutyl)-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 106140156) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(4-amino-2,2-dimethylbutyl)-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-(4-amino-2,2-dimethylbutyl)-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106140156 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(4-amino-2,2-dimethylbutyl)-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC(C)(CCN)CNC(=O)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,4-5-13)8-15-11(17)9-3-6-14-10(16)7-9/h3,6-7H,4-5,8,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | IVYLWPWMAZIYAU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |