C15H24N4O2 — CID 77026876
N-[2-[(5-amino-5-hydroxyiminopentyl)amino]ethyl]-4-methylbenzamide (PubChem CID 77026876) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[2-[(5-amino-5-hydroxyiminopentyl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(5-amino-5-hydroxyiminopentyl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 77026876 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-[2-[(5-amino-5-hydroxyiminopentyl)amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNCCCCC(N)=NO)cc1 |
| InChI | InChI=1S/C15H24N4O2/c1-12-5-7-13(8-6-12)15(20)18-11-10-17-9-3-2-4-14(16)19-21/h5-8,17,21H,2-4,9-11H2,1H3,(H2,16,19)(H,18,20) |
| InChIKey | ICKAPBYPEQCDEN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|