C24H25N5O2 — CID 126672927
N-[3-(dimethylamino)propyl]-4-[3-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-6-yl]benzamide (PubChem CID 126672927) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[3-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-6-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[3-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-6-yl]benzamide |
|---|---|
| PubChem CID | 126672927 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[3-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-6-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cn3c(-c4cccc(O)c4)cnc3cn2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-28(2)12-4-11-25-24(31)18-9-7-17(8-10-18)21-16-29-22(14-27-23(29)15-26-21)19-5-3-6-20(30)13-19/h3,5-10,13-16,30H,4,11-12H2,1-2H3,(H,25,31) |
| InChIKey | PVGXBTHTIQBEHU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|