C26H29N5O2 — CID 24853014
4-(1-benzoyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl)-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 24853014) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-(1-benzoyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl)-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 4-(1-benzoyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl)-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 24853014 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 4-(1-benzoyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl)-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cnc3c(c2)N(C(=O)c2ccccc2)CCN3)cc1 |
| InChI | InChI=1S/C26H29N5O2/c1-30(2)15-6-13-28-25(32)20-11-9-19(10-12-20)22-17-23-24(29-18-22)27-14-16-31(23)26(33)21-7-4-3-5-8-21/h3-5,7-12,17-18H,6,13-16H2,1-2H3,(H,27,29)(H,28,32) |
| InChIKey | IGKMEUSJVNUDEY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|