C27H21N3O2 — CID 71717004
N-benzyl-2-(4-phenoxyphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 71717004) has the molecular formula C27H21N3O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-benzyl-2-(4-phenoxyphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-benzyl-2-(4-phenoxyphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 71717004 |
| Molecular Formula | C27H21N3O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-benzyl-2-(4-phenoxyphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2nc(-c3ccc(Oc4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H21N3O2/c31-27(28-18-19-7-3-1-4-8-19)21-13-16-24-25(17-21)30-26(29-24)20-11-14-23(15-12-20)32-22-9-5-2-6-10-22/h1-17H,18H2,(H,28,31)(H,29,30) |
| InChIKey | MZTHUIKIAQADHQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |