C21H15FN4O3 — CID 141342688
4-[[[2-(6-fluoro-3-pyridinyl)-3H-benzimidazole-5-carbonyl]amino]methyl]benzoic acid (PubChem CID 141342688) has the molecular formula C21H15FN4O3 and a molecular weight of 390.37 g/mol. Its IUPAC name is 4-[[[2-(6-fluoro-3-pyridinyl)-3H-benzimidazole-5-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(6-fluoro-3-pyridinyl)-3H-benzimidazole-5-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 141342688 |
| Molecular Formula | C21H15FN4O3 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-[[[2-(6-fluoro-3-pyridinyl)-3H-benzimidazole-5-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccc3nc(-c4ccc(F)nc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C21H15FN4O3/c22-18-8-6-15(11-23-18)19-25-16-7-5-14(9-17(16)26-19)20(27)24-10-12-1-3-13(4-2-12)21(28)29/h1-9,11H,10H2,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | APPOEUOJSRGTBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|