C19H23ClF3N3O — CID 143373172
6-chloro-N-cyclopentyl-2-methyl-5-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine;ethane (PubChem CID 143373172) has the molecular formula C19H23ClF3N3O and a molecular weight of 401.86 g/mol. Its IUPAC name is 6-chloro-N-cyclopentyl-2-methyl-5-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine;ethane.
| Compound Name | 6-chloro-N-cyclopentyl-2-methyl-5-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 143373172 |
| Molecular Formula | C19H23ClF3N3O |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 6-chloro-N-cyclopentyl-2-methyl-5-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine;ethane |
| SMILES | CC.Cc1nc(Cl)c(-c2cccc(OC(F)(F)F)c2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C17H17ClF3N3O.C2H6/c1-10-22-15(18)14(16(23-10)24-12-6-2-3-7-12)11-5-4-8-13(9-11)25-17(19,20)21;1-2/h4-5,8-9,12H,2-3,6-7H2,1H3,(H,22,23,24);1-2H3 |
| InChIKey | JMQOOXXNIGFGRJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |