C17H22N4 — CID 150663318
4-N-cyclopentyl-2-ethyl-5-phenylpyrimidine-4,6-diamine (PubChem CID 150663318) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-ethyl-5-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-2-ethyl-5-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 150663318 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-N-cyclopentyl-2-ethyl-5-phenylpyrimidine-4,6-diamine |
| SMILES | CCc1nc(N)c(-c2ccccc2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C17H22N4/c1-2-14-20-16(18)15(12-8-4-3-5-9-12)17(21-14)19-13-10-6-7-11-13/h3-5,8-9,13H,2,6-7,10-11H2,1H3,(H3,18,19,20,21) |
| InChIKey | JEIJWYBUHYGZDM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |