C17H15ClN6O4 — CID 22531105
4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-pyridin-2-ylpyrimidine-4,6-diamine (PubChem CID 22531105) has the molecular formula C17H15ClN6O4 and a molecular weight of 402.80 g/mol. Its IUPAC name is 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-pyridin-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-pyridin-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22531105 |
| Molecular Formula | C17H15ClN6O4 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-pyridin-2-ylpyrimidine-4,6-diamine |
| SMILES | COc1cc(OC)c(Nc2ncnc(Nc3ccccn3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H15ClN6O4/c1-27-12-8-13(28-2)11(7-10(12)18)22-16-15(24(25)26)17(21-9-20-16)23-14-5-3-4-6-19-14/h3-9H,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | JBSRRIJEQNMMAN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|