C14H15Cl2N5O2 — CID 23478636
4-N-tert-butyl-6-N-(3,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23478636) has the molecular formula C14H15Cl2N5O2 and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-N-tert-butyl-6-N-(3,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-tert-butyl-6-N-(3,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478636 |
| Molecular Formula | C14H15Cl2N5O2 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-N-tert-butyl-6-N-(3,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CC(C)(C)Nc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15Cl2N5O2/c1-14(2,3)20-13-11(21(22)23)12(17-7-18-13)19-10-5-8(15)4-9(16)6-10/h4-7H,1-3H3,(H2,17,18,19,20) |
| InChIKey | WVNKNHGNGQEFBP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|