C18H13Cl2N5O3 — CID 23483576
1-[4-[[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 23483576) has the molecular formula C18H13Cl2N5O3 and a molecular weight of 418.24 g/mol. Its IUPAC name is 1-[4-[[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 23483576 |
| Molecular Formula | C18H13Cl2N5O3 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 1-[4-[[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc(Nc3cc(Cl)cc(Cl)c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13Cl2N5O3/c1-10(26)11-2-4-14(5-3-11)23-17-16(25(27)28)18(22-9-21-17)24-15-7-12(19)6-13(20)8-15/h2-9H,1H3,(H2,21,22,23,24) |
| InChIKey | BMAOOKJDSQXVFU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|