C18H18ClN5O — CID 19138859
4-N-(2-chloro-3-pyridinyl)-6-(4-propan-2-ylphenoxy)pyrimidine-4,5-diamine (PubChem CID 19138859) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-(4-propan-2-ylphenoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-(4-propan-2-ylphenoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19138859 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-(4-propan-2-ylphenoxy)pyrimidine-4,5-diamine |
| SMILES | CC(C)c1ccc(Oc2ncnc(Nc3cccnc3Cl)c2N)cc1 |
| InChI | InChI=1S/C18H18ClN5O/c1-11(2)12-5-7-13(8-6-12)25-18-15(20)17(22-10-23-18)24-14-4-3-9-21-16(14)19/h3-11H,20H2,1-2H3,(H,22,23,24) |
| InChIKey | AFLOORKSORYOCB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|