C15H20N4O — CID 47419458
N,N-diethyl-2-[(3-methylquinoxalin-2-yl)amino]acetamide (PubChem CID 47419458) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N,N-diethyl-2-[(3-methylquinoxalin-2-yl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[(3-methylquinoxalin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 47419458 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N,N-diethyl-2-[(3-methylquinoxalin-2-yl)amino]acetamide |
| SMILES | CCN(CC)C(=O)CNc1nc2ccccc2nc1C |
| InChI | InChI=1S/C15H20N4O/c1-4-19(5-2)14(20)10-16-15-11(3)17-12-8-6-7-9-13(12)18-15/h6-9H,4-5,10H2,1-3H3,(H,16,18) |
| InChIKey | XUEJOOCZLZIQPU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |