C5H10N4S — CID 103364841
5-(2,2-dimethylhydrazinyl)-1,2-thiazol-3-amine (PubChem CID 103364841) has the molecular formula C5H10N4S and a molecular weight of 158.23 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)-1,2-thiazol-3-amine.
| Compound Name | 5-(2,2-dimethylhydrazinyl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103364841 |
| Molecular Formula | C5H10N4S |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-(2,2-dimethylhydrazinyl)-1,2-thiazol-3-amine |
| SMILES | CN(C)Nc1cc(N)ns1 |
| InChI | InChI=1S/C5H10N4S/c1-9(2)7-5-3-4(6)8-10-5/h3,7H,1-2H3,(H2,6,8) |
| InChIKey | UHRRRTYHQDEBKD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|