C10H9F2N3S — CID 103360175
5-N-[(3,4-difluorophenyl)methyl]-1,2-thiazole-3,5-diamine (PubChem CID 103360175) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-N-[(3,4-difluorophenyl)methyl]-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-[(3,4-difluorophenyl)methyl]-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360175 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-N-[(3,4-difluorophenyl)methyl]-1,2-thiazole-3,5-diamine |
| SMILES | Nc1cc(NCc2ccc(F)c(F)c2)sn1 |
| InChI | InChI=1S/C10H9F2N3S/c11-7-2-1-6(3-8(7)12)5-14-10-4-9(13)15-16-10/h1-4,14H,5H2,(H2,13,15) |
| InChIKey | FQHHVDUUCKTJNI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |