C9H18N4O2S2 — CID 103359211
N-[3-[(3-amino-1,2-thiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 103359211) has the molecular formula C9H18N4O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[3-[(3-amino-1,2-thiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[(3-amino-1,2-thiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 103359211 |
| Molecular Formula | C9H18N4O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[3-[(3-amino-1,2-thiazol-5-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1cc(N)ns1)S(C)(=O)=O |
| InChI | InChI=1S/C9H18N4O2S2/c1-3-13(17(2,14)15)6-4-5-11-9-7-8(10)12-16-9/h7,11H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | SUNPDCYQDBMESA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|