C11H17F2N5O — CID 114073067
2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-ethylamino]-N-ethylacetamide (PubChem CID 114073067) has the molecular formula C11H17F2N5O and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 114073067 |
| Molecular Formula | C11H17F2N5O |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C11H17F2N5O/c1-3-15-9(19)6-18(4-2)11-8(13)5-7(12)10(16-11)17-14/h5H,3-4,6,14H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | HZJNERSFUVUISG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|