C15H19FN4O — CID 83165492
2-[(5-amino-7-fluoroquinolin-8-yl)-ethylamino]-N-ethylacetamide (PubChem CID 83165492) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[(5-amino-7-fluoroquinolin-8-yl)-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(5-amino-7-fluoroquinolin-8-yl)-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 83165492 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(5-amino-7-fluoroquinolin-8-yl)-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C15H19FN4O/c1-3-18-13(21)9-20(4-2)15-11(16)8-12(17)10-6-5-7-19-14(10)15/h5-8H,3-4,9,17H2,1-2H3,(H,18,21) |
| InChIKey | VLENLALPEUBXDA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|