C11H16ClN3O — CID 133382755
2-[(3-chloro-2-pyridinyl)-ethylamino]-N-ethylacetamide (PubChem CID 133382755) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 133382755 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1ncccc1Cl |
| InChI | InChI=1S/C11H16ClN3O/c1-3-13-10(16)8-15(4-2)11-9(12)6-5-7-14-11/h5-7H,3-4,8H2,1-2H3,(H,13,16) |
| InChIKey | HVZQZOUSGMJSTA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |