C13H21ClN2 — CID 135025261
N,N-dibutyl-3-chloropyridin-2-amine (PubChem CID 135025261) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is N,N-dibutyl-3-chloropyridin-2-amine.
| Compound Name | N,N-dibutyl-3-chloropyridin-2-amine |
|---|---|
| PubChem CID | 135025261 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N,N-dibutyl-3-chloropyridin-2-amine |
| SMILES | CCCCN(CCCC)c1ncccc1Cl |
| InChI | InChI=1S/C13H21ClN2/c1-3-5-10-16(11-6-4-2)13-12(14)8-7-9-15-13/h7-9H,3-6,10-11H2,1-2H3 |
| InChIKey | GNNJPOOSXZEZBZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |