C15H27N3 — CID 62279311
N,N-dibutyl-3-(methylaminomethyl)pyridin-2-amine (PubChem CID 62279311) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N-dibutyl-3-(methylaminomethyl)pyridin-2-amine.
| Compound Name | N,N-dibutyl-3-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62279311 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N-dibutyl-3-(methylaminomethyl)pyridin-2-amine |
| SMILES | CCCCN(CCCC)c1ncccc1CNC |
| InChI | InChI=1S/C15H27N3/c1-4-6-11-18(12-7-5-2)15-14(13-16-3)9-8-10-17-15/h8-10,16H,4-7,11-13H2,1-3H3 |
| InChIKey | HTDDQTMNHYMWJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |