C11H16Cl2N2 — CID 63388310
3-chloro-N-(3-chloropropyl)-N-propan-2-ylpyridin-2-amine (PubChem CID 63388310) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 3-chloro-N-(3-chloropropyl)-N-propan-2-ylpyridin-2-amine.
| Compound Name | 3-chloro-N-(3-chloropropyl)-N-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 63388310 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-chloro-N-(3-chloropropyl)-N-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)N(CCCCl)c1ncccc1Cl |
| InChI | InChI=1S/C11H16Cl2N2/c1-9(2)15(8-4-6-12)11-10(13)5-3-7-14-11/h3,5,7,9H,4,6,8H2,1-2H3 |
| InChIKey | DIXVKYUUEMXNJL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|