C10H15ClN2O — CID 115689322
4-[(3-chloro-2-pyridinyl)-methylamino]butan-2-ol (PubChem CID 115689322) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 4-[(3-chloro-2-pyridinyl)-methylamino]butan-2-ol.
| Compound Name | 4-[(3-chloro-2-pyridinyl)-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 115689322 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-[(3-chloro-2-pyridinyl)-methylamino]butan-2-ol |
| SMILES | CC(O)CCN(C)c1ncccc1Cl |
| InChI | InChI=1S/C10H15ClN2O/c1-8(14)5-7-13(2)10-9(11)4-3-6-12-10/h3-4,6,8,14H,5,7H2,1-2H3 |
| InChIKey | QDYAWHOTSMHXOQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |