C16H14FN3 — CID 83173957
7-fluoro-8-N-methyl-8-N-phenylquinoline-5,8-diamine (PubChem CID 83173957) has the molecular formula C16H14FN3 and a molecular weight of 267.31 g/mol. Its IUPAC name is 7-fluoro-8-N-methyl-8-N-phenylquinoline-5,8-diamine.
| Compound Name | 7-fluoro-8-N-methyl-8-N-phenylquinoline-5,8-diamine |
|---|---|
| PubChem CID | 83173957 |
| Molecular Formula | C16H14FN3 |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 7-fluoro-8-N-methyl-8-N-phenylquinoline-5,8-diamine |
| SMILES | CN(c1ccccc1)c1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C16H14FN3/c1-20(11-6-3-2-4-7-11)16-13(17)10-14(18)12-8-5-9-19-15(12)16/h2-10H,18H2,1H3 |
| InChIKey | DUUNETJUTHVONG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|