C14H21F2N3O — CID 63076799
N-ethyl-2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]acetamide (PubChem CID 63076799) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is N-ethyl-2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]acetamide.
| Compound Name | N-ethyl-2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]acetamide |
|---|---|
| PubChem CID | 63076799 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-ethyl-2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]acetamide |
| SMILES | CCNC(=O)CN(CC)c1c(F)cc(CNC)cc1F |
| InChI | InChI=1S/C14H21F2N3O/c1-4-18-13(20)9-19(5-2)14-11(15)6-10(8-17-3)7-12(14)16/h6-7,17H,4-5,8-9H2,1-3H3,(H,18,20) |
| InChIKey | LLRPCKFBARAYSP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|