C15H23F2N3O — CID 63076971
2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]-N-propan-2-ylacetamide (PubChem CID 63076971) has the molecular formula C15H23F2N3O and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]-N-propan-2-ylacetamide.
| Compound Name | 2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 63076971 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-[N-ethyl-2,6-difluoro-4-(methylaminomethyl)anilino]-N-propan-2-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)c1c(F)cc(CNC)cc1F |
| InChI | InChI=1S/C15H23F2N3O/c1-5-20(9-14(21)19-10(2)3)15-12(16)6-11(8-18-4)7-13(15)17/h6-7,10,18H,5,8-9H2,1-4H3,(H,19,21) |
| InChIKey | WVJGRIBCIWXECG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|