C12H17FN2O2 — CID 54980999
N-ethyl-2-[2-fluoro-4-(hydroxymethyl)-N-methylanilino]acetamide (PubChem CID 54980999) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is N-ethyl-2-[2-fluoro-4-(hydroxymethyl)-N-methylanilino]acetamide.
| Compound Name | N-ethyl-2-[2-fluoro-4-(hydroxymethyl)-N-methylanilino]acetamide |
|---|---|
| PubChem CID | 54980999 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-ethyl-2-[2-fluoro-4-(hydroxymethyl)-N-methylanilino]acetamide |
| SMILES | CCNC(=O)CN(C)c1ccc(CO)cc1F |
| InChI | InChI=1S/C12H17FN2O2/c1-3-14-12(17)7-15(2)11-5-4-9(8-16)6-10(11)13/h4-6,16H,3,7-8H2,1-2H3,(H,14,17) |
| InChIKey | SLZFVNBJLFZFJO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|