C15H24FN3O — CID 63059492
2-[4-[(tert-butylamino)methyl]-2-fluoro-N-methylanilino]-N-methylacetamide (PubChem CID 63059492) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[4-[(tert-butylamino)methyl]-2-fluoro-N-methylanilino]-N-methylacetamide.
| Compound Name | 2-[4-[(tert-butylamino)methyl]-2-fluoro-N-methylanilino]-N-methylacetamide |
|---|---|
| PubChem CID | 63059492 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[4-[(tert-butylamino)methyl]-2-fluoro-N-methylanilino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)c1ccc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H24FN3O/c1-15(2,3)18-9-11-6-7-13(12(16)8-11)19(5)10-14(20)17-4/h6-8,18H,9-10H2,1-5H3,(H,17,20) |
| InChIKey | LMDUGARXVMLMOC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|