C14H20F4N2 — CID 63058994
4-[(tert-butylamino)methyl]-2-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 63058994) has the molecular formula C14H20F4N2 and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-2-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[(tert-butylamino)methyl]-2-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 63058994 |
| Molecular Formula | C14H20F4N2 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-2-fluoro-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CN(CC(F)(F)F)c1ccc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C14H20F4N2/c1-13(2,3)19-8-10-5-6-12(11(15)7-10)20(4)9-14(16,17)18/h5-7,19H,8-9H2,1-4H3 |
| InChIKey | DMZGOEIURXQCSH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|