C16H28FN3 — CID 63700770
N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63700770) has the molecular formula C16H28FN3 and a molecular weight of 281.42 g/mol. Its IUPAC name is N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63700770 |
| Molecular Formula | C16H28FN3 |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | N'-[4-[(tert-butylamino)methyl]-2-fluorophenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1ccc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C16H28FN3/c1-16(2,3)18-12-13-7-8-15(14(17)11-13)20(6)10-9-19(4)5/h7-8,11,18H,9-10,12H2,1-6H3 |
| InChIKey | DGGYNIQITPKECV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|